About 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine
3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine (PubChem CID 3705223) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine.
Molecular Properties
| Compound Name | 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine |
| PubChem CID | 3705223 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine |
| SMILES | [H]/N=C1\C=C(OCC)CC(C)(C)C1 |
| InChI | InChI=1S/C10H17NO/c1-4-12-9-5-8(11)6-10(2,3)7-9/h5,11H,4,6-7H2,1-3H3/b11-8+ |
| InChIKey | SEQJHGPDUXYADM-DHZHZOJOSA-N |
| XLogP | 2.75 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine?
The IUPAC name of 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine (CID 3705223) is 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine.
What is the SMILES notation for 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine?
The canonical SMILES for 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine is [H]/N=C1\C=C(OCC)CC(C)(C)C1.
What is the InChIKey of 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine?
The InChIKey is SEQJHGPDUXYADM-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H17NO/c1-4-12-9-5-8(11)6-10(2,3)7-9/h5,11H,4,6-7H2,1-3H3/b11-8+.
What are the key properties of 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine?
3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine has a molecular weight of 167.25 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine is sourced from PubChem (CID 3705223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).