C11H16IN5O — CID 11142946
1-methyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)pyridin-1-ium-4-carbohydrazide iodide (PubChem CID 11142946) has the molecular formula C11H16IN5O and a molecular weight of 361.19 g/mol. Its IUPAC name is 1-methyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)pyridin-1-ium-4-carbohydrazide iodide.
| Compound Name | 1-methyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)pyridin-1-ium-4-carbohydrazide iodide |
|---|---|
| PubChem CID | 11142946 |
| Molecular Formula | C11H16IN5O |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 1-methyl-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)pyridin-1-ium-4-carbohydrazide iodide |
| SMILES | C[n+]1ccc(C(=O)NNC2=NCCCN2)cc1.[I-] |
| InChI | InChI=1S/C11H15N5O.HI/c1-16-7-3-9(4-8-16)10(17)14-15-11-12-5-2-6-13-11;/h3-4,7-8H,2,5-6H2,1H3,(H2,12,13,17);1H |
| InChIKey | HPSPJDVLSBRXII-UHFFFAOYSA-N |
| XLogP | -3.90 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|