C12H16N4O — CID 10353883
N'-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)benzohydrazide (PubChem CID 10353883) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is N'-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)benzohydrazide.
| Compound Name | N'-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 10353883 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | N'-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)benzohydrazide |
| SMILES | O=C(NNC1=NCCCCN1)c1ccccc1 |
| InChI | InChI=1S/C12H16N4O/c17-11(10-6-2-1-3-7-10)15-16-12-13-8-4-5-9-14-12/h1-3,6-7H,4-5,8-9H2,(H,15,17)(H2,13,14,16) |
| InChIKey | LRDMQHUGXAJPMH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|