C13H13F3N4O3 — CID 54085033
2-benzamido-2-(4,5-dihydro-1H-imidazol-2-ylamino)-3,3,3-trifluoropropanoic acid (PubChem CID 54085033) has the molecular formula C13H13F3N4O3 and a molecular weight of 330.27 g/mol. Its IUPAC name is 2-benzamido-2-(4,5-dihydro-1H-imidazol-2-ylamino)-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-benzamido-2-(4,5-dihydro-1H-imidazol-2-ylamino)-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 54085033 |
| Molecular Formula | C13H13F3N4O3 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-benzamido-2-(4,5-dihydro-1H-imidazol-2-ylamino)-3,3,3-trifluoropropanoic acid |
| SMILES | O=C(NC(NC1=NCCN1)(C(=O)O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H13F3N4O3/c14-13(15,16)12(10(22)23,20-11-17-6-7-18-11)19-9(21)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,19,21)(H,22,23)(H2,17,18,20) |
| InChIKey | MPVVTPUNMVVOCR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|