C13H15FN2O3S — CID 111433038
2-[2-[[5-[(2-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethoxy]ethanol (PubChem CID 111433038) has the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[2-[[5-[(2-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethoxy]ethanol.
| Compound Name | 2-[2-[[5-[(2-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethoxy]ethanol |
|---|---|
| PubChem CID | 111433038 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[2-[[5-[(2-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethoxy]ethanol |
| SMILES | OCCOCCSc1nnc(Cc2ccccc2F)o1 |
| InChI | InChI=1S/C13H15FN2O3S/c14-11-4-2-1-3-10(11)9-12-15-16-13(19-12)20-8-7-18-6-5-17/h1-4,17H,5-9H2 |
| InChIKey | XOIMCTWGPMJGRF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|