C22H22N4O5S — CID 71596852
1-[[5-[2-(2-hydroxyethoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 71596852) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is 1-[[5-[2-(2-hydroxyethoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 1-[[5-[2-(2-hydroxyethoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71596852 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-[[5-[2-(2-hydroxyethoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccccc2)(c2ccccc2)N1Cc1nnc(SCCOCCO)o1 |
| InChI | InChI=1S/C22H22N4O5S/c27-11-12-30-13-14-32-21-25-24-18(31-21)15-26-20(29)23-19(28)22(26,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,27H,11-15H2,(H,23,28,29) |
| InChIKey | IHXKKPVROHYCML-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|