C23H44O5Si — CID 11144432
methyl (E,5S,6S,7R)-7-[(4R,5S)-2,2-ditert-butyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-4,5-dimethyloct-3-enoate (PubChem CID 11144432) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is methyl (E,5S,6S,7R)-7-[(4R,5S)-2,2-ditert-butyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-4,5-dimethyloct-3-enoate.
| Compound Name | methyl (E,5S,6S,7R)-7-[(4R,5S)-2,2-ditert-butyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-4,5-dimethyloct-3-enoate |
|---|---|
| PubChem CID | 11144432 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | methyl (E,5S,6S,7R)-7-[(4R,5S)-2,2-ditert-butyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-4,5-dimethyloct-3-enoate |
| SMILES | COC(=O)C/C=C(\C)[C@H](C)[C@H](O)[C@@H](C)[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)OC[C@@H]1C |
| InChI | InChI=1S/C23H44O5Si/c1-15(12-13-19(24)26-11)17(3)20(25)18(4)21-16(2)14-27-29(28-21,22(5,6)7)23(8,9)10/h12,16-18,20-21,25H,13-14H2,1-11H3/b15-12+/t16-,17-,18+,20-,21+/m0/s1 |
| InChIKey | CRTVYSPZMLQQCL-UNJFURNXSA-N |
| XLogP | 5.22 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|