C23H37N7 — CID 111516611
N-ethyl-4-[(4-propan-2-ylphenyl)methyl]-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide (PubChem CID 111516611) has the molecular formula C23H37N7 and a molecular weight of 411.60 g/mol. Its IUPAC name is N-ethyl-4-[(4-propan-2-ylphenyl)methyl]-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-[(4-propan-2-ylphenyl)methyl]-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111516611 |
| Molecular Formula | C23H37N7 |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | N-ethyl-4-[(4-propan-2-ylphenyl)methyl]-N'-[4-(1,2,4-triazol-4-yl)butyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCn1cnnc1)N1CCN(Cc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H37N7/c1-4-24-23(25-11-5-6-12-29-18-26-27-19-29)30-15-13-28(14-16-30)17-21-7-9-22(10-8-21)20(2)3/h7-10,18-20H,4-6,11-17H2,1-3H3,(H,24,25) |
| InChIKey | LDEDLFHVLOIEDE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|