C19H27BrIN5S — CID 111523833
1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111523833) has the molecular formula C19H27BrIN5S and a molecular weight of 564.34 g/mol. Its IUPAC name is 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111523833 |
| Molecular Formula | C19H27BrIN5S |
| Molecular Weight | 564.34 g/mol |
| Exact Mass | 563.02 |
| IUPAC Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCC1CCN(c2ccc(Br)cc2)C1.I |
| InChI | InChI=1S/C19H26BrN5S.HI/c1-3-21-19(24-12-18-22-10-14(2)26-18)23-11-15-8-9-25(13-15)17-6-4-16(20)5-7-17;/h4-7,10,15H,3,8-9,11-13H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | KDKTURNNXUSZQM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|