C18H37FO2Si2 — CID 11152626
tert-butyl-[(2R,3Z)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluorohexa-3,5-dienoxy]-dimethylsilane (PubChem CID 11152626) has the molecular formula C18H37FO2Si2 and a molecular weight of 360.66 g/mol. Its IUPAC name is tert-butyl-[(2R,3Z)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluorohexa-3,5-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3Z)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluorohexa-3,5-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11152626 |
| Molecular Formula | C18H37FO2Si2 |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | tert-butyl-[(2R,3Z)-2-[tert-butyl(dimethyl)silyl]oxy-4-fluorohexa-3,5-dienoxy]-dimethylsilane |
| SMILES | C=C/C(F)=C/[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H37FO2Si2/c1-12-15(19)13-16(21-23(10,11)18(5,6)7)14-20-22(8,9)17(2,3)4/h12-13,16H,1,14H2,2-11H3/b15-13-/t16-/m1/s1 |
| InChIKey | NEQWMLRJQYMELJ-UGEDRFTOSA-N |
| XLogP | 6.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|