C15H32O2Si2 — CID 154718522
tert-butyl-dimethyl-[(3E)-5-trimethylsilyloxyhexa-3,5-dienoxy]silane (PubChem CID 154718522) has the molecular formula C15H32O2Si2 and a molecular weight of 300.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3E)-5-trimethylsilyloxyhexa-3,5-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(3E)-5-trimethylsilyloxyhexa-3,5-dienoxy]silane |
|---|---|
| PubChem CID | 154718522 |
| Molecular Formula | C15H32O2Si2 |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | tert-butyl-dimethyl-[(3E)-5-trimethylsilyloxyhexa-3,5-dienoxy]silane |
| SMILES | C=C(/C=C/CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H32O2Si2/c1-14(17-18(5,6)7)12-10-11-13-16-19(8,9)15(2,3)4/h10,12H,1,11,13H2,2-9H3/b12-10+ |
| InChIKey | RDBOLMCBYZPKDH-ZRDIBKRKSA-N |
| XLogP | 5.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|