C30H29NO2 — CID 11154798
tert-butyl (2S)-2-(benzhydrylideneamino)-3-naphthalen-2-ylpropanoate (PubChem CID 11154798) has the molecular formula C30H29NO2 and a molecular weight of 435.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-3-naphthalen-2-ylpropanoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-naphthalen-2-ylpropanoate |
|---|---|
| PubChem CID | 11154798 |
| Molecular Formula | C30H29NO2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-naphthalen-2-ylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc2ccccc2c1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H29NO2/c1-30(2,3)33-29(32)27(21-22-18-19-23-12-10-11-17-26(23)20-22)31-28(24-13-6-4-7-14-24)25-15-8-5-9-16-25/h4-20,27H,21H2,1-3H3/t27-/m0/s1 |
| InChIKey | KBVQZMUOYBFKOO-MHZLTWQESA-N |
| XLogP | 6.63 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|