C23H24F3NO6S — CID 11156274
trifluoromethanesulfonate;(1S,5R)-5,8,8-trimethyl-1-(4-phenylpyridin-1-ium-1-carbonyl)-3-oxabicyclo[3.2.1]octan-2-one (PubChem CID 11156274) has the molecular formula C23H24F3NO6S and a molecular weight of 499.51 g/mol. Its IUPAC name is trifluoromethanesulfonate;(1S,5R)-5,8,8-trimethyl-1-(4-phenylpyridin-1-ium-1-carbonyl)-3-oxabicyclo[3.2.1]octan-2-one.
| Compound Name | trifluoromethanesulfonate;(1S,5R)-5,8,8-trimethyl-1-(4-phenylpyridin-1-ium-1-carbonyl)-3-oxabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 11156274 |
| Molecular Formula | C23H24F3NO6S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | trifluoromethanesulfonate;(1S,5R)-5,8,8-trimethyl-1-(4-phenylpyridin-1-ium-1-carbonyl)-3-oxabicyclo[3.2.1]octan-2-one |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)[n+]1ccc(-c3ccccc3)cc1)C(=O)OC2.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C22H24NO3.CHF3O3S/c1-20(2)21(3)11-12-22(20,19(25)26-15-21)18(24)23-13-9-17(10-14-23)16-7-5-4-6-8-16;2-1(3,4)8(5,6)7/h4-10,13-14H,11-12,15H2,1-3H3;(H,5,6,7)/q+1;/p-1/t21-,22-;/m0./s1 |
| InChIKey | KPUXNMWNPLNKMQ-VROPFNGYSA-M |
| XLogP | 3.70 |
| TPSA | 104.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|