C30H42N4O6S — CID 11157563
3-ethyl-N-[(2S,3R)-3-hydroxy-4-(3-methylbutylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid (PubChem CID 11157563) has the molecular formula C30H42N4O6S and a molecular weight of 586.76 g/mol. Its IUPAC name is 3-ethyl-N-[(2S,3R)-3-hydroxy-4-(3-methylbutylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid.
| Compound Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-(3-methylbutylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid |
|---|---|
| PubChem CID | 11157563 |
| Molecular Formula | C30H42N4O6S |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-(3-methylbutylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid |
| SMILES | CCn1cc2c3c(cc(C(=O)N[C@@H](Cc4ccccc4)[C@H](O)CNCCC(C)C)cc31)N(C)S(=O)(=O)CC2.O=CO |
| InChI | InChI=1S/C29H40N4O4S.CH2O2/c1-5-33-19-22-12-14-38(36,37)32(4)25-16-23(17-26(33)28(22)25)29(35)31-24(15-21-9-7-6-8-10-21)27(34)18-30-13-11-20(2)3;2-1-3/h6-10,16-17,19-20,24,27,30,34H,5,11-15,18H2,1-4H3,(H,31,35);1H,(H,2,3)/t24-,27+;/m0./s1 |
| InChIKey | KXNMRCAQALJIPH-LHIMUUITSA-N |
| XLogP | 3.02 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|