C33H46N4O2S — CID 69146112
3-ethyl-N-[(2S,3R)-3-hydroxy-1-phenyl-4-[(1-propylcyclohexyl)amino]butan-2-yl]-9-methyl-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide (PubChem CID 69146112) has the molecular formula C33H46N4O2S and a molecular weight of 562.82 g/mol. Its IUPAC name is 3-ethyl-N-[(2S,3R)-3-hydroxy-1-phenyl-4-[(1-propylcyclohexyl)amino]butan-2-yl]-9-methyl-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide.
| Compound Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-1-phenyl-4-[(1-propylcyclohexyl)amino]butan-2-yl]-9-methyl-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 69146112 |
| Molecular Formula | C33H46N4O2S |
| Molecular Weight | 562.82 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-1-phenyl-4-[(1-propylcyclohexyl)amino]butan-2-yl]-9-methyl-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide |
| SMILES | CCCC1(NC[C@@H](O)[C@H](Cc2ccccc2)NC(=O)c2cc3c4c(cn(CC)c4c2)CCSN3C)CCCCC1 |
| InChI | InChI=1S/C33H46N4O2S/c1-4-15-33(16-10-7-11-17-33)34-22-30(38)27(19-24-12-8-6-9-13-24)35-32(39)26-20-28-31-25(14-18-40-36(28)3)23-37(5-2)29(31)21-26/h6,8-9,12-13,20-21,23,27,30,34,38H,4-5,7,10-11,14-19,22H2,1-3H3,(H,35,39)/t27-,30+/m0/s1 |
| InChIKey | IOQAGUIRKBQRDK-BHBYDHKZSA-N |
| XLogP | 6.10 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.82 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|