C27H36N4O5S — CID 70336321
3-ethyl-N-[(2S)-3-hydroxy-4-(2-methoxyethylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide (PubChem CID 70336321) has the molecular formula C27H36N4O5S and a molecular weight of 528.68 g/mol. Its IUPAC name is 3-ethyl-N-[(2S)-3-hydroxy-4-(2-methoxyethylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide.
| Compound Name | 3-ethyl-N-[(2S)-3-hydroxy-4-(2-methoxyethylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 70336321 |
| Molecular Formula | C27H36N4O5S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 3-ethyl-N-[(2S)-3-hydroxy-4-(2-methoxyethylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide |
| SMILES | CCn1cc2c3c(cc(C(=O)N[C@@H](Cc4ccccc4)C(O)CNCCOC)cc31)N(C)S(=O)(=O)CC2 |
| InChI | InChI=1S/C27H36N4O5S/c1-4-31-18-20-10-13-37(34,35)30(2)23-15-21(16-24(31)26(20)23)27(33)29-22(14-19-8-6-5-7-9-19)25(32)17-28-11-12-36-3/h5-9,15-16,18,22,25,28,32H,4,10-14,17H2,1-3H3,(H,29,33)/t22-,25?/m0/s1 |
| InChIKey | MBRGQLSYEWWXPJ-XADRRFQNSA-N |
| XLogP | 1.92 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|