C29H38N4O6S — CID 11444503
3-ethyl-N-[(2S,3R)-3-hydroxy-4-[(1-methylcyclopropyl)amino]-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid (PubChem CID 11444503) has the molecular formula C29H38N4O6S and a molecular weight of 570.71 g/mol. Its IUPAC name is 3-ethyl-N-[(2S,3R)-3-hydroxy-4-[(1-methylcyclopropyl)amino]-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid.
| Compound Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-[(1-methylcyclopropyl)amino]-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid |
|---|---|
| PubChem CID | 11444503 |
| Molecular Formula | C29H38N4O6S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-[(1-methylcyclopropyl)amino]-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid |
| SMILES | CCn1cc2c3c(cc(C(=O)N[C@@H](Cc4ccccc4)[C@H](O)CNC4(C)CC4)cc31)N(C)S(=O)(=O)CC2.O=CO |
| InChI | InChI=1S/C28H36N4O4S.CH2O2/c1-4-32-18-20-10-13-37(35,36)31(3)23-15-21(16-24(32)26(20)23)27(34)30-22(14-19-8-6-5-7-9-19)25(33)17-29-28(2)11-12-28;2-1-3/h5-9,15-16,18,22,25,29,33H,4,10-14,17H2,1-3H3,(H,30,34);1H,(H,2,3)/t22-,25+;/m0./s1 |
| InChIKey | NWCUUCMAKIYKDP-RKGTXJDOSA-N |
| XLogP | 2.53 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|