C32H44N4O2S — CID 69146055
N-[(2S,3R)-4-[(4,4-dimethylcyclohexyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-3-ethyl-9-methyl-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide (PubChem CID 69146055) has the molecular formula C32H44N4O2S and a molecular weight of 548.80 g/mol. Its IUPAC name is N-[(2S,3R)-4-[(4,4-dimethylcyclohexyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-3-ethyl-9-methyl-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide.
| Compound Name | N-[(2S,3R)-4-[(4,4-dimethylcyclohexyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-3-ethyl-9-methyl-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 69146055 |
| Molecular Formula | C32H44N4O2S |
| Molecular Weight | 548.80 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | N-[(2S,3R)-4-[(4,4-dimethylcyclohexyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-3-ethyl-9-methyl-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide |
| SMILES | CCn1cc2c3c(cc(C(=O)N[C@@H](Cc4ccccc4)[C@H](O)CNC4CCC(C)(C)CC4)cc31)N(C)SCC2 |
| InChI | InChI=1S/C32H44N4O2S/c1-5-36-21-23-13-16-39-35(4)27-18-24(19-28(36)30(23)27)31(38)34-26(17-22-9-7-6-8-10-22)29(37)20-33-25-11-14-32(2,3)15-12-25/h6-10,18-19,21,25-26,29,33,37H,5,11-17,20H2,1-4H3,(H,34,38)/t26-,29+/m0/s1 |
| InChIKey | PBHJWPBDILKVIS-LITSAYRRSA-N |
| XLogP | 5.56 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.80 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|