C30H38N4O4S — CID 69173440
3,9-diethyl-N-[(2S,3R)-3-hydroxy-4-[(2-oxooxan-4-yl)amino]-1-phenylbutan-2-yl]-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide (PubChem CID 69173440) has the molecular formula C30H38N4O4S and a molecular weight of 550.73 g/mol. Its IUPAC name is 3,9-diethyl-N-[(2S,3R)-3-hydroxy-4-[(2-oxooxan-4-yl)amino]-1-phenylbutan-2-yl]-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide.
| Compound Name | 3,9-diethyl-N-[(2S,3R)-3-hydroxy-4-[(2-oxooxan-4-yl)amino]-1-phenylbutan-2-yl]-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 69173440 |
| Molecular Formula | C30H38N4O4S |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 3,9-diethyl-N-[(2S,3R)-3-hydroxy-4-[(2-oxooxan-4-yl)amino]-1-phenylbutan-2-yl]-10-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide |
| SMILES | CCN1SCCc2cn(CC)c3cc(C(=O)N[C@@H](Cc4ccccc4)[C@H](O)CNC4CCOC(=O)C4)cc1c23 |
| InChI | InChI=1S/C30H38N4O4S/c1-3-33-19-21-11-13-39-34(4-2)26-16-22(15-25(33)29(21)26)30(37)32-24(14-20-8-6-5-7-9-20)27(35)18-31-23-10-12-38-28(36)17-23/h5-9,15-16,19,23-24,27,31,35H,3-4,10-14,17-18H2,1-2H3,(H,32,37)/t23?,24-,27+/m0/s1 |
| InChIKey | VVALPOLATSXMSZ-BQYSROJOSA-N |
| XLogP | 3.69 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|