C29H36N4O4S — CID 11753540
3-ethyl-N-[(2S,3R)-3-hydroxy-4-(2-methylbut-3-yn-2-ylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide (PubChem CID 11753540) has the molecular formula C29H36N4O4S and a molecular weight of 536.70 g/mol. Its IUPAC name is 3-ethyl-N-[(2S,3R)-3-hydroxy-4-(2-methylbut-3-yn-2-ylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide.
| Compound Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-(2-methylbut-3-yn-2-ylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 11753540 |
| Molecular Formula | C29H36N4O4S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-(2-methylbut-3-yn-2-ylamino)-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide |
| SMILES | C#CC(C)(C)NC[C@@H](O)[C@H](Cc1ccccc1)NC(=O)c1cc2c3c(cn(CC)c3c1)CCS(=O)(=O)N2C |
| InChI | InChI=1S/C29H36N4O4S/c1-6-29(3,4)30-18-26(34)23(15-20-11-9-8-10-12-20)31-28(35)22-16-24-27-21(13-14-38(36,37)32(24)5)19-33(7-2)25(27)17-22/h1,8-12,16-17,19,23,26,30,34H,7,13-15,18H2,2-5H3,(H,31,35)/t23-,26+/m0/s1 |
| InChIKey | BTVCBLMHYFUYFG-JYFHCDHNSA-N |
| XLogP | 2.69 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|