C29H40N4O6S2 — CID 11261958
3-ethyl-N-[(2S,3R)-4-(2-ethylsulfanylethylamino)-3-hydroxy-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid (PubChem CID 11261958) has the molecular formula C29H40N4O6S2 and a molecular weight of 604.80 g/mol. Its IUPAC name is 3-ethyl-N-[(2S,3R)-4-(2-ethylsulfanylethylamino)-3-hydroxy-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid.
| Compound Name | 3-ethyl-N-[(2S,3R)-4-(2-ethylsulfanylethylamino)-3-hydroxy-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid |
|---|---|
| PubChem CID | 11261958 |
| Molecular Formula | C29H40N4O6S2 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 3-ethyl-N-[(2S,3R)-4-(2-ethylsulfanylethylamino)-3-hydroxy-1-phenylbutan-2-yl]-9-methyl-10,10-dioxo-10λ6-thia-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraene-6-carboxamide;formic acid |
| SMILES | CCSCCNC[C@@H](O)[C@H](Cc1ccccc1)NC(=O)c1cc2c3c(cn(CC)c3c1)CCS(=O)(=O)N2C.O=CO |
| InChI | InChI=1S/C28H38N4O4S2.CH2O2/c1-4-32-19-21-11-14-38(35,36)31(3)24-16-22(17-25(32)27(21)24)28(34)30-23(15-20-9-7-6-8-10-20)26(33)18-29-12-13-37-5-2;2-1-3/h6-10,16-17,19,23,26,29,33H,4-5,11-15,18H2,1-3H3,(H,30,34);1H,(H,2,3)/t23-,26+;/m0./s1 |
| InChIKey | QQRCNDLKGANMSS-HWJSIUBNSA-N |
| XLogP | 2.73 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|