C18H28IN3O — CID 111579478
2-(2-methylprop-2-enyl)-1-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]guanidine;hydroiodide (PubChem CID 111579478) has the molecular formula C18H28IN3O and a molecular weight of 429.35 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-1-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-(2-methylprop-2-enyl)-1-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111579478 |
| Molecular Formula | C18H28IN3O |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-1-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(\N)NCCCOC1CCCc2ccccc21.I |
| InChI | InChI=1S/C18H27N3O.HI/c1-14(2)13-21-18(19)20-11-6-12-22-17-10-5-8-15-7-3-4-9-16(15)17;/h3-4,7,9,17H,1,5-6,8,10-13H2,2H3,(H3,19,20,21);1H |
| InChIKey | DKTBFTXABJIRAH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|