C17H21NO2 — CID 111630024
4-(2-phenyl-5,7-dihydro-4H-furo[2,3-c]pyridin-6-yl)butan-1-ol (PubChem CID 111630024) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-(2-phenyl-5,7-dihydro-4H-furo[2,3-c]pyridin-6-yl)butan-1-ol.
| Compound Name | 4-(2-phenyl-5,7-dihydro-4H-furo[2,3-c]pyridin-6-yl)butan-1-ol |
|---|---|
| PubChem CID | 111630024 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 4-(2-phenyl-5,7-dihydro-4H-furo[2,3-c]pyridin-6-yl)butan-1-ol |
| SMILES | OCCCCN1CCc2cc(-c3ccccc3)oc2C1 |
| InChI | InChI=1S/C17H21NO2/c19-11-5-4-9-18-10-8-15-12-16(20-17(15)13-18)14-6-2-1-3-7-14/h1-3,6-7,12,19H,4-5,8-11,13H2 |
| InChIKey | FNQULSFOTNKBOO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|