C23H15N3O4 — CID 11165403
2-(5H-benzo[c][1]benzazepin-6-ylmethyl)-5-nitroisoindole-1,3-dione (PubChem CID 11165403) has the molecular formula C23H15N3O4 and a molecular weight of 397.39 g/mol. Its IUPAC name is 2-(5H-benzo[c][1]benzazepin-6-ylmethyl)-5-nitroisoindole-1,3-dione.
| Compound Name | 2-(5H-benzo[c][1]benzazepin-6-ylmethyl)-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11165403 |
| Molecular Formula | C23H15N3O4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-(5H-benzo[c][1]benzazepin-6-ylmethyl)-5-nitroisoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CC1=c2ccccc2=Cc2ccccc2N1 |
| InChI | InChI=1S/C23H15N3O4/c27-22-18-10-9-16(26(29)30)12-19(18)23(28)25(22)13-21-17-7-3-1-5-14(17)11-15-6-2-4-8-20(15)24-21/h1-12,24H,13H2 |
| InChIKey | LGFWGXAQGAPJAR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|