C22H25F5N2O7S — CID 11168921
N-[5-[(1R)-2-[1-[4-(difluoromethoxy)phenyl]but-3-enylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 11168921) has the molecular formula C22H25F5N2O7S and a molecular weight of 556.51 g/mol. Its IUPAC name is N-[5-[(1R)-2-[1-[4-(difluoromethoxy)phenyl]but-3-enylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[5-[(1R)-2-[1-[4-(difluoromethoxy)phenyl]but-3-enylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11168921 |
| Molecular Formula | C22H25F5N2O7S |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | N-[5-[(1R)-2-[1-[4-(difluoromethoxy)phenyl]but-3-enylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CCC(NC[C@H](O)c1ccc(O)c(NS(C)(=O)=O)c1)c1ccc(OC(F)F)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H24F2N2O5S.C2HF3O2/c1-3-4-16(13-5-8-15(9-6-13)29-20(21)22)23-12-19(26)14-7-10-18(25)17(11-14)24-30(2,27)28;3-2(4,5)1(6)7/h3,5-11,16,19-20,23-26H,1,4,12H2,2H3;(H,6,7)/t16?,19-;/m0./s1 |
| InChIKey | KAQSZQOOZJSWCU-BKEIEZAHSA-N |
| XLogP | 3.94 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|