C22H32N2O8Sn — CID 11169074
dibutyltin;bis(3-(2,5-dioxopyrrol-1-yl)propanoic acid) (PubChem CID 11169074) has the molecular formula C22H32N2O8Sn and a molecular weight of 571.22 g/mol. Its IUPAC name is dibutyltin;bis(3-(2,5-dioxopyrrol-1-yl)propanoic acid).
| Compound Name | dibutyltin;bis(3-(2,5-dioxopyrrol-1-yl)propanoic acid) |
|---|---|
| PubChem CID | 11169074 |
| Molecular Formula | C22H32N2O8Sn |
| Molecular Weight | 571.22 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | dibutyltin;bis(3-(2,5-dioxopyrrol-1-yl)propanoic acid) |
| SMILES | CCCC[Sn]CCCC.O=C(O)CCN1C(=O)C=CC1=O.O=C(O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/2C7H7NO4.2C4H9.Sn/c2*9-5-1-2-6(10)8(5)4-3-7(11)12;2*1-3-4-2;/h2*1-2H,3-4H2,(H,11,12);2*1,3-4H2,2H3; |
| InChIKey | GUIPCSVONGZAOQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|