C36H56O6Si2 — CID 11169666
3-[2-[(2R)-1-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-triethylsilyloxyoxolan-2-yl]propan-2-yl]-1,3-dioxolan-2-yl]propanal (PubChem CID 11169666) has the molecular formula C36H56O6Si2 and a molecular weight of 641.01 g/mol. Its IUPAC name is 3-[2-[(2R)-1-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-triethylsilyloxyoxolan-2-yl]propan-2-yl]-1,3-dioxolan-2-yl]propanal.
| Compound Name | 3-[2-[(2R)-1-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-triethylsilyloxyoxolan-2-yl]propan-2-yl]-1,3-dioxolan-2-yl]propanal |
|---|---|
| PubChem CID | 11169666 |
| Molecular Formula | C36H56O6Si2 |
| Molecular Weight | 641.01 g/mol |
| Exact Mass | 640.36 |
| IUPAC Name | 3-[2-[(2R)-1-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-triethylsilyloxyoxolan-2-yl]propan-2-yl]-1,3-dioxolan-2-yl]propanal |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H]1C[C@@H](C)C1(CCC=O)OCCO1 |
| InChI | InChI=1S/C36H56O6Si2/c1-8-43(9-2,10-3)42-34-27-30(41-33(34)26-29(4)36(22-17-23-37)38-24-25-39-36)28-40-44(35(5,6)7,31-18-13-11-14-19-31)32-20-15-12-16-21-32/h11-16,18-21,23,29-30,33-34H,8-10,17,22,24-28H2,1-7H3/t29-,30+,33-,34-/m1/s1 |
| InChIKey | FMROMFGZMCNSPL-GBWWDHKLSA-N |
| XLogP | 6.86 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.01 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|