C31H48O4Si2 — CID 102089639
(2S)-3-[(2S,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-triethylsilyloxyoxolan-2-yl]-2-methylpropanal (PubChem CID 102089639) has the molecular formula C31H48O4Si2 and a molecular weight of 540.89 g/mol. Its IUPAC name is (2S)-3-[(2S,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-triethylsilyloxyoxolan-2-yl]-2-methylpropanal.
| Compound Name | (2S)-3-[(2S,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-triethylsilyloxyoxolan-2-yl]-2-methylpropanal |
|---|---|
| PubChem CID | 102089639 |
| Molecular Formula | C31H48O4Si2 |
| Molecular Weight | 540.89 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | (2S)-3-[(2S,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-triethylsilyloxyoxolan-2-yl]-2-methylpropanal |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1C[C@H](C)C=O |
| InChI | InChI=1S/C31H48O4Si2/c1-8-36(9-2,10-3)35-30-22-26(34-29(30)21-25(4)23-32)24-33-37(31(5,6)7,27-17-13-11-14-18-27)28-19-15-12-16-20-28/h11-20,23,25-26,29-30H,8-10,21-22,24H2,1-7H3/t25-,26+,29-,30-/m0/s1 |
| InChIKey | IPYRELQZFUWANY-ZDIDPRFDSA-N |
| XLogP | 6.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.89 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|