C38H60O7Si2 — CID 102392249
4-O-[(4R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-triethylsilyloxyethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate (PubChem CID 102392249) has the molecular formula C38H60O7Si2 and a molecular weight of 685.06 g/mol. Its IUPAC name is 4-O-[(4R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-triethylsilyloxyethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate.
| Compound Name | 4-O-[(4R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-triethylsilyloxyethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate |
|---|---|
| PubChem CID | 102392249 |
| Molecular Formula | C38H60O7Si2 |
| Molecular Weight | 685.06 g/mol |
| Exact Mass | 684.39 |
| IUPAC Name | 4-O-[(4R)-4-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-triethylsilyloxyethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate |
| SMILES | CCCC[C@](CCC=O)(OC(=O)CCC(=O)OCC)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C38H60O7Si2/c1-9-14-28-38(29-21-30-39,44-36(41)27-26-35(40)42-10-2)34(45-46(11-3,12-4)13-5)31-43-47(37(6,7)8,32-22-17-15-18-23-32)33-24-19-16-20-25-33/h15-20,22-25,30,34H,9-14,21,26-29,31H2,1-8H3/t34-,38+/m0/s1 |
| InChIKey | INMRGBKGWOXQFA-HCJVMEMPSA-N |
| XLogP | 7.75 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.06 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|