C34H54O4Si2 — CID 134851825
1-[(2R,4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]propan-2-one (PubChem CID 134851825) has the molecular formula C34H54O4Si2 and a molecular weight of 582.97 g/mol. Its IUPAC name is 1-[(2R,4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]propan-2-one.
| Compound Name | 1-[(2R,4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 134851825 |
| Molecular Formula | C34H54O4Si2 |
| Molecular Weight | 582.97 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | 1-[(2R,4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C34H54O4Si2/c1-25(2)39(26(3)4,27(5)6)38-30-22-29(21-28(7)35)37-31(23-30)24-36-40(34(8,9)10,32-17-13-11-14-18-32)33-19-15-12-16-20-33/h11-20,25-27,29-31H,21-24H2,1-10H3/t29-,30+,31-/m0/s1 |
| InChIKey | LFBATWZTMHKHDN-YPKYBTACSA-N |
| XLogP | 7.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.97 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|