C26H34O5Si — CID 101333648
2-[(3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]acetaldehyde (PubChem CID 101333648) has the molecular formula C26H34O5Si and a molecular weight of 454.64 g/mol. Its IUPAC name is 2-[(3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]acetaldehyde.
| Compound Name | 2-[(3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 101333648 |
| Molecular Formula | C26H34O5Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2-[(3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]acetaldehyde |
| SMILES | COC1C[C@H]2[C@@H](O1)O[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]2CC=O |
| InChI | InChI=1S/C26H34O5Si/c1-26(2,3)32(19-11-7-5-8-12-19,20-13-9-6-10-14-20)29-18-23-21(15-16-27)22-17-24(28-4)31-25(22)30-23/h5-14,16,21-25H,15,17-18H2,1-4H3/t21-,22+,23+,24?,25+/m0/s1 |
| InChIKey | UQMFGPATZNKBGQ-WUCMLYBJSA-N |
| XLogP | 3.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|