C22H25NO6S — CID 11177940
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-methylsulfanylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol (PubChem CID 11177940) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-methylsulfanylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-methylsulfanylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11177940 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-methylsulfanylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol |
| SMILES | CSc1ccc(Cc2c[nH]c3cccc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c23)cc1 |
| InChI | InChI=1S/C22H25NO6S/c1-30-14-7-5-12(6-8-14)9-13-10-23-15-3-2-4-16(18(13)15)28-22-21(27)20(26)19(25)17(11-24)29-22/h2-8,10,17,19-27H,9,11H2,1H3/t17-,19-,20+,21-,22-/m1/s1 |
| InChIKey | GJPMFWJSNJAODK-MIUGBVLSSA-N |
| XLogP | 1.66 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |