C23H34O9 — CID 11178532
dimethyl (2R,3R,5R)-2-(2-methoxy-2-oxoethyl)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,3-dicarboxylate (PubChem CID 11178532) has the molecular formula C23H34O9 and a molecular weight of 454.52 g/mol. Its IUPAC name is dimethyl (2R,3R,5R)-2-(2-methoxy-2-oxoethyl)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,3-dicarboxylate.
| Compound Name | dimethyl (2R,3R,5R)-2-(2-methoxy-2-oxoethyl)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11178532 |
| Molecular Formula | C23H34O9 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | dimethyl (2R,3R,5R)-2-(2-methoxy-2-oxoethyl)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,3-dicarboxylate |
| SMILES | CCCCCCCCCC1=CO[C@@]2(C[C@@H](C(=O)OC)[C@](CC(=O)OC)(C(=O)OC)O2)C1=O |
| InChI | InChI=1S/C23H34O9/c1-5-6-7-8-9-10-11-12-16-15-31-23(19(16)25)13-17(20(26)29-3)22(32-23,21(27)30-4)14-18(24)28-2/h15,17H,5-14H2,1-4H3/t17-,22+,23+/m0/s1 |
| InChIKey | LXJYEYMKHDHGGY-JJEOQYAHSA-N |
| XLogP | 2.99 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|