C16H12F8P2S2 — CID 11179146
[4-(4-dimethylphosphinothioyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorophenyl]-dimethyl-sulfanylidene-λ5-phosphane (PubChem CID 11179146) has the molecular formula C16H12F8P2S2 and a molecular weight of 482.34 g/mol. Its IUPAC name is [4-(4-dimethylphosphinothioyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorophenyl]-dimethyl-sulfanylidene-λ5-phosphane.
| Compound Name | [4-(4-dimethylphosphinothioyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorophenyl]-dimethyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 11179146 |
| Molecular Formula | C16H12F8P2S2 |
| Molecular Weight | 482.34 g/mol |
| Exact Mass | 481.97 |
| IUPAC Name | [4-(4-dimethylphosphinothioyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorophenyl]-dimethyl-sulfanylidene-λ5-phosphane |
| SMILES | CP(C)(=S)c1c(F)c(F)c(-c2c(F)c(F)c(P(C)(C)=S)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C16H12F8P2S2/c1-25(2,27)15-11(21)7(17)5(8(18)12(15)22)6-9(19)13(23)16(26(3,4)28)14(24)10(6)20/h1-4H3 |
| InChIKey | YUKBQZKEUQWRFB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|