C26H31Cl2N5O2 — CID 11179871
4-[[N-cyclohexyl-C-(3-oxopiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 11179871) has the molecular formula C26H31Cl2N5O2 and a molecular weight of 516.47 g/mol. Its IUPAC name is 4-[[N-cyclohexyl-C-(3-oxopiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 4-[[N-cyclohexyl-C-(3-oxopiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 11179871 |
| Molecular Formula | C26H31Cl2N5O2 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 4-[[N-cyclohexyl-C-(3-oxopiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | O=C1CN(/C(=N\C2CCCCC2)Nc2ccc(C(=O)NCCc3ccc(Cl)cc3Cl)cc2)CCN1 |
| InChI | InChI=1S/C26H31Cl2N5O2/c27-20-9-6-18(23(28)16-20)12-13-30-25(35)19-7-10-22(11-8-19)32-26(31-21-4-2-1-3-5-21)33-15-14-29-24(34)17-33/h6-11,16,21H,1-5,12-15,17H2,(H,29,34)(H,30,35)(H,31,32) |
| InChIKey | HNBBDTOVUVDAFG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|