C27H35N7O4 — CID 11179960
2-[7-methoxy-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)quinazolin-4-yl]-1-(3-methylphenyl)guanidine (PubChem CID 11179960) has the molecular formula C27H35N7O4 and a molecular weight of 521.62 g/mol. Its IUPAC name is 2-[7-methoxy-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)quinazolin-4-yl]-1-(3-methylphenyl)guanidine.
| Compound Name | 2-[7-methoxy-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)quinazolin-4-yl]-1-(3-methylphenyl)guanidine |
|---|---|
| PubChem CID | 11179960 |
| Molecular Formula | C27H35N7O4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 2-[7-methoxy-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)quinazolin-4-yl]-1-(3-methylphenyl)guanidine |
| SMILES | COc1cc2nc(N3CCOCC3)nc(/N=C(\N)Nc3cccc(C)c3)c2cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C27H35N7O4/c1-19-4-3-5-20(16-19)29-26(28)31-25-21-17-24(38-15-8-33-6-11-36-12-7-33)23(35-2)18-22(21)30-27(32-25)34-9-13-37-14-10-34/h3-5,16-18H,6-15H2,1-2H3,(H3,28,29,30,31,32) |
| InChIKey | WJZLXOBLUXFNQI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|