C20H27N5S — CID 111818826
N'-[2-(4-propan-2-ylphenyl)cyclopropyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111818826) has the molecular formula C20H27N5S and a molecular weight of 369.54 g/mol. Its IUPAC name is N'-[2-(4-propan-2-ylphenyl)cyclopropyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(4-propan-2-ylphenyl)cyclopropyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111818826 |
| Molecular Formula | C20H27N5S |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N'-[2-(4-propan-2-ylphenyl)cyclopropyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | CC(C)c1ccc(C2CC2/N=C(\N)N2CCN(c3nccs3)CC2)cc1 |
| InChI | InChI=1S/C20H27N5S/c1-14(2)15-3-5-16(6-4-15)17-13-18(17)23-19(21)24-8-10-25(11-9-24)20-22-7-12-26-20/h3-7,12,14,17-18H,8-11,13H2,1-2H3,(H2,21,23) |
| InChIKey | JLTWWBZLIAIZGA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|