C19H24FN7 — CID 111887875
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-prop-2-enylguanidine (PubChem CID 111887875) has the molecular formula C19H24FN7 and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-prop-2-enylguanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111887875 |
| Molecular Formula | C19H24FN7 |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C19H24FN7/c1-4-8-21-19(24-12-18-26-25-13(2)27(18)3)22-9-7-14-11-23-17-10-15(20)5-6-16(14)17/h4-6,10-11,23H,1,7-9,12H2,2-3H3,(H2,21,22,24) |
| InChIKey | XBPMQVKXGWVNSR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|