C23H26FN7 — CID 111973400
2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111973400) has the molecular formula C23H26FN7 and a molecular weight of 419.51 g/mol. Its IUPAC name is 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111973400 |
| Molecular Formula | C23H26FN7 |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine |
| SMILES | Cc1nnc(CN/C(=N\Cc2ccccc2)NCCc2c[nH]c3ccc(F)cc23)n1C |
| InChI | InChI=1S/C23H26FN7/c1-16-29-30-22(31(16)2)15-28-23(27-13-17-6-4-3-5-7-17)25-11-10-18-14-26-21-9-8-19(24)12-20(18)21/h3-9,12,14,26H,10-11,13,15H2,1-2H3,(H2,25,27,28) |
| InChIKey | VAHNHVAXLJBGCU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|