C28H37NO2 — CID 11189319
(7aS)-3,3-dimethyl-6,6-bis[(2,4,6-trimethylphenyl)methyl]-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 11189319) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is (7aS)-3,3-dimethyl-6,6-bis[(2,4,6-trimethylphenyl)methyl]-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (7aS)-3,3-dimethyl-6,6-bis[(2,4,6-trimethylphenyl)methyl]-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 11189319 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | (7aS)-3,3-dimethyl-6,6-bis[(2,4,6-trimethylphenyl)methyl]-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | Cc1cc(C)c(CC2(Cc3c(C)cc(C)cc3C)C[C@H]3COC(C)(C)N3C2=O)c(C)c1 |
| InChI | InChI=1S/C28H37NO2/c1-17-9-19(3)24(20(4)10-17)14-28(15-25-21(5)11-18(2)12-22(25)6)13-23-16-31-27(7,8)29(23)26(28)30/h9-12,23H,13-16H2,1-8H3/t23-/m0/s1 |
| InChIKey | LBZUZNUYWMVZGY-QHCPKHFHSA-N |
| XLogP | 5.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |