C40H61NO2 — CID 11456062
(7aS)-3,3-dimethyl-6,6-bis[[2,4,6-tri(propan-2-yl)phenyl]methyl]-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 11456062) has the molecular formula C40H61NO2 and a molecular weight of 587.93 g/mol. Its IUPAC name is (7aS)-3,3-dimethyl-6,6-bis[[2,4,6-tri(propan-2-yl)phenyl]methyl]-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (7aS)-3,3-dimethyl-6,6-bis[[2,4,6-tri(propan-2-yl)phenyl]methyl]-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 11456062 |
| Molecular Formula | C40H61NO2 |
| Molecular Weight | 587.93 g/mol |
| Exact Mass | 587.47 |
| IUPAC Name | (7aS)-3,3-dimethyl-6,6-bis[[2,4,6-tri(propan-2-yl)phenyl]methyl]-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC(C)c1cc(C(C)C)c(CC2(Cc3c(C(C)C)cc(C(C)C)cc3C(C)C)C[C@H]3COC(C)(C)N3C2=O)c(C(C)C)c1 |
| InChI | InChI=1S/C40H61NO2/c1-23(2)29-15-32(25(5)6)36(33(16-29)26(7)8)20-40(19-31-22-43-39(13,14)41(31)38(40)42)21-37-34(27(9)10)17-30(24(3)4)18-35(37)28(11)12/h15-18,23-28,31H,19-22H2,1-14H3/t31-/m0/s1 |
| InChIKey | XQDCOWTYIBOFPO-HKBQPEDESA-N |
| XLogP | 10.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.93 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |