C24H30F2N4O — CID 111920581
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(4-phenyloxan-4-yl)methyl]guanidine (PubChem CID 111920581) has the molecular formula C24H30F2N4O and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(4-phenyloxan-4-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(4-phenyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111920581 |
| Molecular Formula | C24H30F2N4O |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(4-phenyloxan-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC1(c2ccccc2)CCOCC1)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C24H30F2N4O/c1-27-23(28-17-24(10-13-31-14-11-24)18-5-3-2-4-6-18)29-20-9-12-30(16-20)22-8-7-19(25)15-21(22)26/h2-8,15,20H,9-14,16-17H2,1H3,(H2,27,28,29) |
| InChIKey | PECFJVPZMAUQND-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|