C36H42O8 — CID 11192715
[(2R)-2-[(3aR,5R,6R,6aR)-6-butyl-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-(4-methylbenzoyl)oxyethyl] 4-methylbenzoate (PubChem CID 11192715) has the molecular formula C36H42O8 and a molecular weight of 602.72 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5R,6R,6aR)-6-butyl-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-(4-methylbenzoyl)oxyethyl] 4-methylbenzoate.
| Compound Name | [(2R)-2-[(3aR,5R,6R,6aR)-6-butyl-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-(4-methylbenzoyl)oxyethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 11192715 |
| Molecular Formula | C36H42O8 |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | [(2R)-2-[(3aR,5R,6R,6aR)-6-butyl-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-(4-methylbenzoyl)oxyethyl] 4-methylbenzoate |
| SMILES | CCCC[C@@]1(OCc2ccccc2)[C@@H]([C@@H](COC(=O)c2ccc(C)cc2)OC(=O)c2ccc(C)cc2)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C36H42O8/c1-6-7-21-36(40-22-26-11-9-8-10-12-26)30(42-34-31(36)43-35(4,5)44-34)29(41-33(38)28-19-15-25(3)16-20-28)23-39-32(37)27-17-13-24(2)14-18-27/h8-20,29-31,34H,6-7,21-23H2,1-5H3/t29-,30-,31+,34-,36-/m1/s1 |
| InChIKey | BUQDZAGNQJBSQV-KSBJMCGASA-N |
| XLogP | 6.71 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |