thiiran-2-ylmethyl nitrate

C3H5NO3S — CID 11194356

IUPACthiiran-2-ylmethyl nitrate
SMILESO=[N+]([O-])OCC1CS1
InChIInChI=1S/C3H5NO3S/c5-4(6)7-1-3-2-8-3/h3H,1-2H2
InChIKeyVOPGNSZLECWHSX-UHFFFAOYSA-N
MW135.14 g/mol
LogP0.31
Rot. Bonds3

About thiiran-2-ylmethyl nitrate

thiiran-2-ylmethyl nitrate (PubChem CID 11194356) has the molecular formula C3H5NO3S and a molecular weight of 135.14 g/mol. Its IUPAC name is thiiran-2-ylmethyl nitrate.

Molecular Properties

Compound Namethiiran-2-ylmethyl nitrate
PubChem CID11194356
Molecular FormulaC3H5NO3S
Molecular Weight135.14 g/mol
Exact Mass135.00
IUPAC Namethiiran-2-ylmethyl nitrate
SMILESO=[N+]([O-])OCC1CS1
InChIInChI=1S/C3H5NO3S/c5-4(6)7-1-3-2-8-3/h3H,1-2H2
InChIKeyVOPGNSZLECWHSX-UHFFFAOYSA-N
XLogP0.31
TPSA52.37 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.14
LogP ≤ 50.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze thiiran-2-ylmethyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of thiiran-2-ylmethyl nitrate?
The IUPAC name of thiiran-2-ylmethyl nitrate (CID 11194356) is thiiran-2-ylmethyl nitrate.
What is the SMILES notation for thiiran-2-ylmethyl nitrate?
The canonical SMILES for thiiran-2-ylmethyl nitrate is O=[N+]([O-])OCC1CS1.
What is the InChIKey of thiiran-2-ylmethyl nitrate?
The InChIKey is VOPGNSZLECWHSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO3S/c5-4(6)7-1-3-2-8-3/h3H,1-2H2.
What are the key properties of thiiran-2-ylmethyl nitrate?
thiiran-2-ylmethyl nitrate has a molecular weight of 135.14 g/mol, XLogP of 0.31, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiiran-2-ylmethyl nitrate is sourced from PubChem (CID 11194356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).