C6H9N3O12 — CID 138394254
[(2R,3R,4S,5R,6S)-3,6-dihydroxy-4,5-dinitrooxyoxan-2-yl]methyl nitrate (PubChem CID 138394254) has the molecular formula C6H9N3O12 and a molecular weight of 315.15 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,6-dihydroxy-4,5-dinitrooxyoxan-2-yl]methyl nitrate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,6-dihydroxy-4,5-dinitrooxyoxan-2-yl]methyl nitrate |
|---|---|
| PubChem CID | 138394254 |
| Molecular Formula | C6H9N3O12 |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,6-dihydroxy-4,5-dinitrooxyoxan-2-yl]methyl nitrate |
| SMILES | O=[N+]([O-])OC[C@H]1O[C@H](O)[C@H](O[N+](=O)[O-])[C@@H](O[N+](=O)[O-])[C@@H]1O |
| InChI | InChI=1S/C6H9N3O12/c10-3-2(1-18-7(12)13)19-6(11)5(21-9(16)17)4(3)20-8(14)15/h2-6,10-11H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
| InChIKey | YCJXFHSERGDTTF-DVKNGEFBSA-N |
| XLogP | -2.57 |
| TPSA | 206.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|