C18H21N11O38 — CID 74981698
[2-[4,5-dinitrooxy-2-(nitrooxymethyl)-6-[4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate (PubChem CID 74981698) has the molecular formula C18H21N11O38 and a molecular weight of 999.40 g/mol. Its IUPAC name is [2-[4,5-dinitrooxy-2-(nitrooxymethyl)-6-[4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate.
| Compound Name | [2-[4,5-dinitrooxy-2-(nitrooxymethyl)-6-[4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate |
|---|---|
| PubChem CID | 74981698 |
| Molecular Formula | C18H21N11O38 |
| Molecular Weight | 999.40 g/mol |
| Exact Mass | 999.00 |
| IUPAC Name | [2-[4,5-dinitrooxy-2-(nitrooxymethyl)-6-[4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate |
| SMILES | O=[N+]([O-])OCC1OC(OC2C(CO[N+](=O)[O-])OC(O[N+](=O)[O-])C(O[N+](=O)[O-])C2O[N+](=O)[O-])C(O[N+](=O)[O-])C(O[N+](=O)[O-])C1OC1OC(CO[N+](=O)[O-])C(O[N+](=O)[O-])C(O[N+](=O)[O-])C1O[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N11O38/c30-19(31)52-1-4-7(58-17-14(65-27(46)47)12(63-25(42)43)9(60-22(36)37)6(56-17)3-54-21(34)35)10(61-23(38)39)13(64-26(44)45)16(55-4)59-8-5(2-53-20(32)33)57-18(67-29(50)51)15(66-28(48)49)11(8)62-24(40)41/h4-18H,1-3H2 |
| InChIKey | FJWGYAHXMCUOOM-UHFFFAOYSA-N |
| XLogP | -5.20 |
| TPSA | 622.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 38 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.40 |
| LogP ≤ 5 | -5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 38 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|