C7H11N3O12 — CID 23279484
[(2R,3R,4S,5R,6R)-4-hydroxy-6-methoxy-3,5-dinitrooxyoxan-2-yl]methyl nitrate (PubChem CID 23279484) has the molecular formula C7H11N3O12 and a molecular weight of 329.17 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4-hydroxy-6-methoxy-3,5-dinitrooxyoxan-2-yl]methyl nitrate.
| Compound Name | [(2R,3R,4S,5R,6R)-4-hydroxy-6-methoxy-3,5-dinitrooxyoxan-2-yl]methyl nitrate |
|---|---|
| PubChem CID | 23279484 |
| Molecular Formula | C7H11N3O12 |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4-hydroxy-6-methoxy-3,5-dinitrooxyoxan-2-yl]methyl nitrate |
| SMILES | CO[C@@H]1O[C@H](CO[N+](=O)[O-])[C@H](O[N+](=O)[O-])[C@H](O)[C@H]1O[N+](=O)[O-] |
| InChI | InChI=1S/C7H11N3O12/c1-18-7-6(22-10(16)17)4(11)5(21-9(14)15)3(20-7)2-19-8(12)13/h3-7,11H,2H2,1H3/t3-,4+,5+,6-,7-/m1/s1 |
| InChIKey | RGINYNXEXIBNIC-VOQCIKJUSA-N |
| XLogP | -1.92 |
| TPSA | 195.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|