C14H20N6O23 — CID 153494875
[(3S,4R,6S)-3-methoxy-6-[(3R,6S)-6-methoxy-4,5-dinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxy-4,5-dinitrooxyoxan-2-yl]methyl nitrate (PubChem CID 153494875) has the molecular formula C14H20N6O23 and a molecular weight of 640.33 g/mol. Its IUPAC name is [(3S,4R,6S)-3-methoxy-6-[(3R,6S)-6-methoxy-4,5-dinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxy-4,5-dinitrooxyoxan-2-yl]methyl nitrate.
| Compound Name | [(3S,4R,6S)-3-methoxy-6-[(3R,6S)-6-methoxy-4,5-dinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxy-4,5-dinitrooxyoxan-2-yl]methyl nitrate |
|---|---|
| PubChem CID | 153494875 |
| Molecular Formula | C14H20N6O23 |
| Molecular Weight | 640.33 g/mol |
| Exact Mass | 640.06 |
| IUPAC Name | [(3S,4R,6S)-3-methoxy-6-[(3R,6S)-6-methoxy-4,5-dinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxy-4,5-dinitrooxyoxan-2-yl]methyl nitrate |
| SMILES | CO[C@H]1OC(CO[N+](=O)[O-])[C@@H](O[C@@H]2OC(CO[N+](=O)[O-])[C@H](OC)[C@@H](O[N+](=O)[O-])C2O[N+](=O)[O-])C(O[N+](=O)[O-])C1O[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N6O23/c1-33-7-5(3-35-15(21)22)38-14(12(43-20(31)32)9(7)40-17(25)26)39-8-6(4-36-16(23)24)37-13(34-2)11(42-19(29)30)10(8)41-18(27)28/h5-14H,3-4H2,1-2H3/t5?,6?,7-,8+,9+,10?,11?,12?,13-,14-/m0/s1 |
| InChIKey | WKMGLAWUYMWWNW-ZWYCKPEBSA-N |
| XLogP | -2.79 |
| TPSA | 360.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.33 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|