C18H23ClN8O — CID 111982089
1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine (PubChem CID 111982089) has the molecular formula C18H23ClN8O and a molecular weight of 402.89 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111982089 |
| Molecular Formula | C18H23ClN8O |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C18H23ClN8O/c1-3-15-25-23-12-27(15)11-10-22-18(20-2)21-9-8-16-24-17(26-28-16)13-4-6-14(19)7-5-13/h4-7,12H,3,8-11H2,1-2H3,(H2,20,21,22) |
| InChIKey | PXYWSJJCHHPECY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|