C21H33IN6O — CID 111996704
N-[2-[[N-[1-(2-cyanophenyl)piperidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111996704) has the molecular formula C21H33IN6O and a molecular weight of 512.44 g/mol. Its IUPAC name is N-[2-[[N-[1-(2-cyanophenyl)piperidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-[1-(2-cyanophenyl)piperidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111996704 |
| Molecular Formula | C21H33IN6O |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N-[2-[[N-[1-(2-cyanophenyl)piperidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C(C)(C)C)NC1CCCN(c2ccccc2C#N)C1.I |
| InChI | InChI=1S/C21H32N6O.HI/c1-21(2,3)19(28)24-11-12-25-20(23-4)26-17-9-7-13-27(15-17)18-10-6-5-8-16(18)14-22;/h5-6,8,10,17H,7,9,11-13,15H2,1-4H3,(H,24,28)(H2,23,25,26);1H |
| InChIKey | QSFQYKWGVPKLNL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|